About 2-amino-3-methyl-1,1-diphenylbutan-1-ol
2-amino-3-methyl-1,1-diphenylbutan-1-ol (PubChem CID 3808242) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-amino-3-methyl-1,1-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-methyl-1,1-diphenylbutan-1-ol |
| PubChem CID | 3808242 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-amino-3-methyl-1,1-diphenylbutan-1-ol |
| SMILES | CC(C)C(N)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-13(2)16(18)17(19,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,19H,18H2,1-2H3 |
| InChIKey | LNQVZZGGOZBOQS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-methyl-1,1-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-1,1-diphenylbutan-1-ol?
The IUPAC name of 2-amino-3-methyl-1,1-diphenylbutan-1-ol (CID 3808242) is 2-amino-3-methyl-1,1-diphenylbutan-1-ol.
What is the SMILES notation for 2-amino-3-methyl-1,1-diphenylbutan-1-ol?
The canonical SMILES for 2-amino-3-methyl-1,1-diphenylbutan-1-ol is CC(C)C(N)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-amino-3-methyl-1,1-diphenylbutan-1-ol?
The InChIKey is LNQVZZGGOZBOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c1-13(2)16(18)17(19,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,19H,18H2,1-2H3.
What are the key properties of 2-amino-3-methyl-1,1-diphenylbutan-1-ol?
2-amino-3-methyl-1,1-diphenylbutan-1-ol has a molecular weight of 255.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-1,1-diphenylbutan-1-ol is sourced from PubChem (CID 3808242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).