About non-8-ene-2,4-diol
non-8-ene-2,4-diol (PubChem CID 3808271) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is non-8-ene-2,4-diol.
Molecular Properties
| Compound Name | non-8-ene-2,4-diol |
| PubChem CID | 3808271 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | non-8-ene-2,4-diol |
| SMILES | C=CCCCC(O)CC(C)O |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-6-9(11)7-8(2)10/h3,8-11H,1,4-7H2,2H3 |
| InChIKey | BCYQTARIMBPDNP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze non-8-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-8-ene-2,4-diol?
The IUPAC name of non-8-ene-2,4-diol (CID 3808271) is non-8-ene-2,4-diol.
What is the SMILES notation for non-8-ene-2,4-diol?
The canonical SMILES for non-8-ene-2,4-diol is C=CCCCC(O)CC(C)O.
What is the InChIKey of non-8-ene-2,4-diol?
The InChIKey is BCYQTARIMBPDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-4-5-6-9(11)7-8(2)10/h3,8-11H,1,4-7H2,2H3.
What are the key properties of non-8-ene-2,4-diol?
non-8-ene-2,4-diol has a molecular weight of 158.24 g/mol, XLogP of 1.47, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for non-8-ene-2,4-diol is sourced from PubChem (CID 3808271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).