C15H21N3O5 — CID 3808618
N-heptyl-2-methyl-3,5-dinitrobenzamide (PubChem CID 3808618) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-heptyl-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-heptyl-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3808618 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-heptyl-2-methyl-3,5-dinitrobenzamide |
| SMILES | CCCCCCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C15H21N3O5/c1-3-4-5-6-7-8-16-15(19)13-9-12(17(20)21)10-14(11(13)2)18(22)23/h9-10H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | LTKWALVUBJIQHJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|