C20H25N3O2 — CID 3809103
2-(2-aminophenyl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)-1,3-oxazole-4-carboxamide (PubChem CID 3809103) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3809103 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(2-aminophenyl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC1C(NC(=O)c2coc(-c3ccccc3N)n2)CC2CC1C2(C)C |
| InChI | InChI=1S/C20H25N3O2/c1-11-14-8-12(20(14,2)3)9-16(11)22-18(24)17-10-25-19(23-17)13-6-4-5-7-15(13)21/h4-7,10-12,14,16H,8-9,21H2,1-3H3,(H,22,24) |
| InChIKey | SBVFJHKNSPAWAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|