About 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole
2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole (PubChem CID 3809277) has the molecular formula C20H13Cl3N2O
and a molecular weight of 403.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole |
| PubChem CID | 3809277 |
| Molecular Formula | C20H13Cl3N2O |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole |
| SMILES | Clc1ccc(-c2nc3ccccc3n2OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H13Cl3N2O/c21-15-8-5-13(6-9-15)20-24-18-3-1-2-4-19(18)25(20)26-12-14-7-10-16(22)11-17(14)23/h1-11H,12H2 |
| InChIKey | ZXHGDABTUSABLI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole?
The IUPAC name of 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole (CID 3809277) is 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole.
What is the SMILES notation for 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole?
The canonical SMILES for 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole is Clc1ccc(-c2nc3ccccc3n2OCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole?
The InChIKey is ZXHGDABTUSABLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl3N2O/c21-15-8-5-13(6-9-15)20-24-18-3-1-2-4-19(18)25(20)26-12-14-7-10-16(22)11-17(14)23/h1-11H,12H2.
What are the key properties of 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole?
2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole has a molecular weight of 403.70 g/mol, XLogP of 6.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-[(2,4-dichlorophenyl)methoxy]benzimidazole is sourced from PubChem (CID 3809277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).