C20H22BrFN2O2 — CID 38095881
N-(4-bromo-2-fluorophenyl)-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 38095881) has the molecular formula C20H22BrFN2O2 and a molecular weight of 421.31 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38095881 |
| Molecular Formula | C20H22BrFN2O2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-1-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(CN2CCC(C(=O)Nc3ccc(Br)cc3F)CC2)c1 |
| InChI | InChI=1S/C20H22BrFN2O2/c1-26-17-4-2-3-14(11-17)13-24-9-7-15(8-10-24)20(25)23-19-6-5-16(21)12-18(19)22/h2-6,11-12,15H,7-10,13H2,1H3,(H,23,25) |
| InChIKey | KWTYNHGPCZQIGG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |