C9H16N2O4 — CID 3809731
4-N,5-N,2,2-tetramethyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 3809731) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-N,5-N,2,2-tetramethyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | 4-N,5-N,2,2-tetramethyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 3809731 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-N,5-N,2,2-tetramethyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | CNC(=O)C1OC(C)(C)OC1C(=O)NC |
| InChI | InChI=1S/C9H16N2O4/c1-9(2)14-5(7(12)10-3)6(15-9)8(13)11-4/h5-6H,1-4H3,(H,10,12)(H,11,13) |
| InChIKey | RJCZQLOBXZGLGZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |