C21H23N5O3S2 — CID 3809832
1-[4-oxo-3-[(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 3809832) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-[4-oxo-3-[(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-oxo-3-[(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3809832 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-[4-oxo-3-[(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrido[1,2-a]pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)N1C(=O)C(=Cc2c(N3CCC(C(N)=O)CC3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C21H23N5O3S2/c1-12(2)26-20(29)15(31-21(26)30)11-14-18(24-9-6-13(7-10-24)17(22)27)23-16-5-3-4-8-25(16)19(14)28/h3-5,8,11-13H,6-7,9-10H2,1-2H3,(H2,22,27) |
| InChIKey | HUNDQRUXOFRUFI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|