C16H13Cl3N2O4S — CID 38104767
(2S)-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 38104767) has the molecular formula C16H13Cl3N2O4S and a molecular weight of 435.72 g/mol. Its IUPAC name is (2S)-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 38104767 |
| Molecular Formula | C16H13Cl3N2O4S |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | (2S)-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1C[C@@H](C(=O)Nc2cc(Cl)c(Cl)cc2Cl)Oc2ccccc21 |
| InChI | InChI=1S/C16H13Cl3N2O4S/c1-26(23,24)21-8-15(25-14-5-3-2-4-13(14)21)16(22)20-12-7-10(18)9(17)6-11(12)19/h2-7,15H,8H2,1H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | KITSDCGTHUQCGB-HNNXBMFYSA-N |
| XLogP | 3.81 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|