C12H11N7 — CID 3810523
N-(1-pyridin-2-ylethylideneamino)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 3810523) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is N-(1-pyridin-2-ylethylideneamino)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(1-pyridin-2-ylethylideneamino)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 3810523 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(1-pyridin-2-ylethylideneamino)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC(=NNc1ccc2nncn2n1)c1ccccn1 |
| InChI | InChI=1S/C12H11N7/c1-9(10-4-2-3-7-13-10)15-16-11-5-6-12-17-14-8-19(12)18-11/h2-8H,1H3,(H,16,18) |
| InChIKey | NPSXXNUFHOMKDH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|