C19H16ClN2OS+ — CID 3810538
3-(4-chlorophenyl)-1-[4-methyl-2-(1-methylpyridin-1-ium-3-yl)-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 3810538) has the molecular formula C19H16ClN2OS+ and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-methyl-2-(1-methylpyridin-1-ium-3-yl)-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-[4-methyl-2-(1-methylpyridin-1-ium-3-yl)-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3810538 |
| Molecular Formula | C19H16ClN2OS+ |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-methyl-2-(1-methylpyridin-1-ium-3-yl)-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | Cc1nc(-c2ccc[n+](C)c2)sc1C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN2OS/c1-13-18(17(23)10-7-14-5-8-16(20)9-6-14)24-19(21-13)15-4-3-11-22(2)12-15/h3-12H,1-2H3/q+1 |
| InChIKey | XQYNVWCATNEHNL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|