About 2-benzylbenzotriazole
2-benzylbenzotriazole (PubChem CID 3810549) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-benzylbenzotriazole.
Molecular Properties
| Compound Name | 2-benzylbenzotriazole |
| PubChem CID | 3810549 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-benzylbenzotriazole |
| SMILES | c1ccc(Cn2nc3ccccc3n2)cc1 |
| InChI | InChI=1S/C13H11N3/c1-2-6-11(7-3-1)10-16-14-12-8-4-5-9-13(12)15-16/h1-9H,10H2 |
| InChIKey | LJVWBACGGDLQQX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylbenzotriazole?
The IUPAC name of 2-benzylbenzotriazole (CID 3810549) is 2-benzylbenzotriazole.
What is the SMILES notation for 2-benzylbenzotriazole?
The canonical SMILES for 2-benzylbenzotriazole is c1ccc(Cn2nc3ccccc3n2)cc1.
What is the InChIKey of 2-benzylbenzotriazole?
The InChIKey is LJVWBACGGDLQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c1-2-6-11(7-3-1)10-16-14-12-8-4-5-9-13(12)15-16/h1-9H,10H2.
What are the key properties of 2-benzylbenzotriazole?
2-benzylbenzotriazole has a molecular weight of 209.25 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylbenzotriazole is sourced from PubChem (CID 3810549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).