C27H29N3O5S — CID 38105840
methyl 3-[[4-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzoate (PubChem CID 38105840) has the molecular formula C27H29N3O5S and a molecular weight of 507.61 g/mol. Its IUPAC name is methyl 3-[[4-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[4-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 38105840 |
| Molecular Formula | C27H29N3O5S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | methyl 3-[[4-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(CN3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)cc2)c1 |
| InChI | InChI=1S/C27H29N3O5S/c1-20-6-12-25(13-7-20)36(33,34)30-16-14-29(15-17-30)19-21-8-10-22(11-9-21)26(31)28-24-5-3-4-23(18-24)27(32)35-2/h3-13,18H,14-17,19H2,1-2H3,(H,28,31) |
| InChIKey | UKLNZTDLQSJEHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |