C20H16N2O2S2 — CID 38113238
1-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 38113238) has the molecular formula C20H16N2O2S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 38113238 |
| Molecular Formula | C20H16N2O2S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[4-[(4-phenyl-1,3-thiazol-2-yl)sulfanylmethyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc(CSc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C20H16N2O2S2/c23-18-10-11-19(24)22(18)16-8-6-14(7-9-16)12-25-20-21-17(13-26-20)15-4-2-1-3-5-15/h1-9,13H,10-12H2 |
| InChIKey | WHHMTDFTTMOLCT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|