C24H20ClN5O4S — CID 38113725
2-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-nitrophenyl)methyl]acetamide (PubChem CID 38113725) has the molecular formula C24H20ClN5O4S and a molecular weight of 509.98 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-nitrophenyl)methyl]acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-nitrophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 38113725 |
| Molecular Formula | C24H20ClN5O4S |
| Molecular Weight | 509.98 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-nitrophenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CSc2nnc(-c3ccccc3Cl)n2-c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20ClN5O4S/c1-34-21-12-11-16(13-20(21)30(32)33)14-26-22(31)15-35-24-28-27-23(18-9-5-6-10-19(18)25)29(24)17-7-3-2-4-8-17/h2-13H,14-15H2,1H3,(H,26,31) |
| InChIKey | LNVDAIUGBDSKOQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|