C19H28N4O6S — CID 38118084
2,2-dimethyl-N-[3-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]propanamide (PubChem CID 38118084) has the molecular formula C19H28N4O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]propanamide |
|---|---|
| PubChem CID | 38118084 |
| Molecular Formula | C19H28N4O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2,2-dimethyl-N-[3-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(C(=O)CCNC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H28N4O6S/c1-14-5-6-15(23(26)27)13-16(14)30(28,29)22-11-9-21(10-12-22)17(24)7-8-20-18(25)19(2,3)4/h5-6,13H,7-12H2,1-4H3,(H,20,25) |
| InChIKey | CMPXLWYPVCHSKU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|