C13H16N3S2+ — CID 3812203
[5-(3,4-dihydro-1H-isoquinolin-2-yl)-1,2,4-dithiazol-3-ylidene]-dimethylazanium (PubChem CID 3812203) has the molecular formula C13H16N3S2+ and a molecular weight of 278.43 g/mol. Its IUPAC name is [5-(3,4-dihydro-1H-isoquinolin-2-yl)-1,2,4-dithiazol-3-ylidene]-dimethylazanium.
| Compound Name | [5-(3,4-dihydro-1H-isoquinolin-2-yl)-1,2,4-dithiazol-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 3812203 |
| Molecular Formula | C13H16N3S2+ |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [5-(3,4-dihydro-1H-isoquinolin-2-yl)-1,2,4-dithiazol-3-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=c1nc(N2CCc3ccccc3C2)ss1 |
| InChI | InChI=1S/C13H16N3S2/c1-15(2)12-14-13(18-17-12)16-8-7-10-5-3-4-6-11(10)9-16/h3-6H,7-9H2,1-2H3/q+1 |
| InChIKey | IVSFEQFIVBBLCO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|