C16H17N3OS — CID 3813109
[2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 3813109) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is [2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 3813109 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [2-(1-amino-2-phenylethyl)-1,3-thiazol-4-yl]-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | NC(Cc1ccccc1)c1nc(C(=O)N2CC=CC2)cs1 |
| InChI | InChI=1S/C16H17N3OS/c17-13(10-12-6-2-1-3-7-12)15-18-14(11-21-15)16(20)19-8-4-5-9-19/h1-7,11,13H,8-10,17H2 |
| InChIKey | GQNGOOHOORLVJA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|