About 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole
2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole (PubChem CID 3813759) has the molecular formula C22H26N2S
and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole |
| PubChem CID | 3813759 |
| Molecular Formula | C22H26N2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole |
| SMILES | Cc1ccc(C2=NNC(C)(c3ccc(C4CCCCC4)cc3)S2)cc1 |
| InChI | InChI=1S/C22H26N2S/c1-16-8-10-19(11-9-16)21-23-24-22(2,25-21)20-14-12-18(13-15-20)17-6-4-3-5-7-17/h8-15,17,24H,3-7H2,1-2H3 |
| InChIKey | NFJLLURVSWCMMA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole?
The IUPAC name of 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole (CID 3813759) is 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole.
What is the SMILES notation for 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole?
The canonical SMILES for 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole is Cc1ccc(C2=NNC(C)(c3ccc(C4CCCCC4)cc3)S2)cc1.
What is the InChIKey of 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole?
The InChIKey is NFJLLURVSWCMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2S/c1-16-8-10-19(11-9-16)21-23-24-22(2,25-21)20-14-12-18(13-15-20)17-6-4-3-5-7-17/h8-15,17,24H,3-7H2,1-2H3.
What are the key properties of 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole?
2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole has a molecular weight of 350.53 g/mol, XLogP of 5.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexylphenyl)-2-methyl-5-(4-methylphenyl)-3H-1,3,4-thiadiazole is sourced from PubChem (CID 3813759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).