About N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide
N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide (PubChem CID 3813981) has the molecular formula C13H10Cl2N2O
and a molecular weight of 281.14 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide |
| PubChem CID | 3813981 |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide |
| SMILES | ON/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C13H10Cl2N2O/c14-10-6-11(15)8-12(7-10)16-13(17-18)9-4-2-1-3-5-9/h1-8,18H,(H,16,17) |
| InChIKey | TYJJIPLMAWAJRR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide?
The IUPAC name of N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide (CID 3813981) is N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide.
What is the SMILES notation for N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide?
The canonical SMILES for N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide is ON/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1.
What is the InChIKey of N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide?
The InChIKey is TYJJIPLMAWAJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O/c14-10-6-11(15)8-12(7-10)16-13(17-18)9-4-2-1-3-5-9/h1-8,18H,(H,16,17).
What are the key properties of N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide?
N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide has a molecular weight of 281.14 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dichlorophenyl)-N-hydroxybenzenecarboximidamide is sourced from PubChem (CID 3813981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).