C26H30N4O4S — CID 38140243
methyl 2-[[1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 38140243) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is methyl 2-[[1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 38140243 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | methyl 2-[[1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2CCN(Cc3nc(-c4cccc(C)c4)no3)CC2)sc2c1CCCC2 |
| InChI | InChI=1S/C26H30N4O4S/c1-16-6-5-7-18(14-16)23-27-21(34-29-23)15-30-12-10-17(11-13-30)24(31)28-25-22(26(32)33-2)19-8-3-4-9-20(19)35-25/h5-7,14,17H,3-4,8-13,15H2,1-2H3,(H,28,31) |
| InChIKey | ZIUGGSMADJSXDR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |