C25H28N4O3 — CID 38142249
1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(4-prop-2-enoxyphenyl)piperidine-4-carboxamide (PubChem CID 38142249) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(4-prop-2-enoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(4-prop-2-enoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38142249 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(4-prop-2-enoxyphenyl)piperidine-4-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2CCN(Cc3nc(-c4ccc(C)cc4)no3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-3-16-31-22-10-8-21(9-11-22)26-25(30)20-12-14-29(15-13-20)17-23-27-24(28-32-23)19-6-4-18(2)5-7-19/h3-11,20H,1,12-17H2,2H3,(H,26,30) |
| InChIKey | QABXWQHUDSKFFL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|