About 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide
1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide (PubChem CID 3814421) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
| PubChem CID | 3814421 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide |
| SMILES | CCCCn1c(C)c(C(N)=O)c(-c2nccs2)c1C |
| InChI | InChI=1S/C14H19N3OS/c1-4-5-7-17-9(2)11(13(15)18)12(10(17)3)14-16-6-8-19-14/h6,8H,4-5,7H2,1-3H3,(H2,15,18) |
| InChIKey | VYKYBERSWVADEP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide?
The IUPAC name of 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide (CID 3814421) is 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide.
What is the SMILES notation for 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide?
The canonical SMILES for 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide is CCCCn1c(C)c(C(N)=O)c(-c2nccs2)c1C.
What is the InChIKey of 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide?
The InChIKey is VYKYBERSWVADEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c1-4-5-7-17-9(2)11(13(15)18)12(10(17)3)14-16-6-8-19-14/h6,8H,4-5,7H2,1-3H3,(H2,15,18).
What are the key properties of 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide?
1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide has a molecular weight of 277.39 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,5-dimethyl-4-(1,3-thiazol-2-yl)pyrrole-3-carboxamide is sourced from PubChem (CID 3814421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).