About 2-acetamido-N,3,3-trimethylbutanamide
2-acetamido-N,3,3-trimethylbutanamide (PubChem CID 3814733) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-acetamido-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | 2-acetamido-N,3,3-trimethylbutanamide |
| PubChem CID | 3814733 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-acetamido-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(NC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-6(12)11-7(8(13)10-5)9(2,3)4/h7H,1-5H3,(H,10,13)(H,11,12) |
| InChIKey | QVSDVIJQXZTBCC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamido-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N,3,3-trimethylbutanamide?
The IUPAC name of 2-acetamido-N,3,3-trimethylbutanamide (CID 3814733) is 2-acetamido-N,3,3-trimethylbutanamide.
What is the SMILES notation for 2-acetamido-N,3,3-trimethylbutanamide?
The canonical SMILES for 2-acetamido-N,3,3-trimethylbutanamide is CNC(=O)C(NC(C)=O)C(C)(C)C.
What is the InChIKey of 2-acetamido-N,3,3-trimethylbutanamide?
The InChIKey is QVSDVIJQXZTBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-6(12)11-7(8(13)10-5)9(2,3)4/h7H,1-5H3,(H,10,13)(H,11,12).
What are the key properties of 2-acetamido-N,3,3-trimethylbutanamide?
2-acetamido-N,3,3-trimethylbutanamide has a molecular weight of 186.25 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N,3,3-trimethylbutanamide is sourced from PubChem (CID 3814733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).