About 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide
4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide (PubChem CID 3814736) has the molecular formula C13H11ClN2O
and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide |
| PubChem CID | 3814736 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide |
| SMILES | ON/C(=N\c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClN2O/c14-11-8-6-10(7-9-11)13(16-17)15-12-4-2-1-3-5-12/h1-9,17H,(H,15,16) |
| InChIKey | FXLBBBVRAIJTQR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide?
The IUPAC name of 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide (CID 3814736) is 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide.
What is the SMILES notation for 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide?
The canonical SMILES for 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide is ON/C(=N\c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide?
The InChIKey is FXLBBBVRAIJTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O/c14-11-8-6-10(7-9-11)13(16-17)15-12-4-2-1-3-5-12/h1-9,17H,(H,15,16).
What are the key properties of 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide?
4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide has a molecular weight of 246.70 g/mol, XLogP of 3.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-hydroxy-N'-phenylbenzenecarboximidamide is sourced from PubChem (CID 3814736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).