C15H17ClN2O — CID 3815118
3-[(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]propan-1-ol (PubChem CID 3815118) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 3-[(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]propan-1-ol.
| Compound Name | 3-[(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]propan-1-ol |
|---|---|
| PubChem CID | 3815118 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[(6-chloro-2,3,4,9-tetrahydrocarbazol-1-ylidene)amino]propan-1-ol |
| SMILES | OCCC/N=C1\CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C15H17ClN2O/c16-10-5-6-13-12(9-10)11-3-1-4-14(15(11)18-13)17-7-2-8-19/h5-6,9,18-19H,1-4,7-8H2/b17-14+ |
| InChIKey | YWBQHOYTDQRWCP-SAPNQHFASA-N |
| XLogP | 3.33 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|