C15H23N3O3 — CID 38154617
N-[4-[(2-methoxyethylcarbamoylamino)methyl]phenyl]-2-methylpropanamide (PubChem CID 38154617) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[4-[(2-methoxyethylcarbamoylamino)methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[(2-methoxyethylcarbamoylamino)methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 38154617 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[4-[(2-methoxyethylcarbamoylamino)methyl]phenyl]-2-methylpropanamide |
| SMILES | COCCNC(=O)NCc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O3/c1-11(2)14(19)18-13-6-4-12(5-7-13)10-17-15(20)16-8-9-21-3/h4-7,11H,8-10H2,1-3H3,(H,18,19)(H2,16,17,20) |
| InChIKey | XEBSIJOXAFTBSG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|