N,N-dibutylsulfamoyl chloride

C8H18ClNO2S — CID 3815528

IUPACN,N-dibutylsulfamoyl chloride
SMILESCCCCN(CCCC)S(=O)(=O)Cl
InChIInChI=1S/C8H18ClNO2S/c1-3-5-7-10(8-6-4-2)13(9,11)12/h3-8H2,1-2H3
InChIKeyVMJGICXHKZERPD-UHFFFAOYSA-N
MW227.76 g/mol
LogP2.37
Rot. Bonds7

About N,N-dibutylsulfamoyl chloride

N,N-dibutylsulfamoyl chloride (PubChem CID 3815528) has the molecular formula C8H18ClNO2S and a molecular weight of 227.76 g/mol. Its IUPAC name is N,N-dibutylsulfamoyl chloride.

Molecular Properties

Compound NameN,N-dibutylsulfamoyl chloride
PubChem CID3815528
Molecular FormulaC8H18ClNO2S
Molecular Weight227.76 g/mol
Exact Mass227.07
IUPAC NameN,N-dibutylsulfamoyl chloride
SMILESCCCCN(CCCC)S(=O)(=O)Cl
InChIInChI=1S/C8H18ClNO2S/c1-3-5-7-10(8-6-4-2)13(9,11)12/h3-8H2,1-2H3
InChIKeyVMJGICXHKZERPD-UHFFFAOYSA-N
XLogP2.37
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.76
LogP ≤ 52.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N,N-dibutylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dibutylsulfamoyl chloride?
The IUPAC name of N,N-dibutylsulfamoyl chloride (CID 3815528) is N,N-dibutylsulfamoyl chloride.
What is the SMILES notation for N,N-dibutylsulfamoyl chloride?
The canonical SMILES for N,N-dibutylsulfamoyl chloride is CCCCN(CCCC)S(=O)(=O)Cl.
What is the InChIKey of N,N-dibutylsulfamoyl chloride?
The InChIKey is VMJGICXHKZERPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNO2S/c1-3-5-7-10(8-6-4-2)13(9,11)12/h3-8H2,1-2H3.
What are the key properties of N,N-dibutylsulfamoyl chloride?
N,N-dibutylsulfamoyl chloride has a molecular weight of 227.76 g/mol, XLogP of 2.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylsulfamoyl chloride is sourced from PubChem (CID 3815528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).