C15H13ClN4O3S — CID 3815623
1-(4-chlorophenyl)-3-[(3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea (PubChem CID 3815623) has the molecular formula C15H13ClN4O3S and a molecular weight of 364.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 3815623 |
| Molecular Formula | C15H13ClN4O3S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3-thiophen-2-yl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)C1CC(c2cccs2)=NO1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN4O3S/c16-9-3-5-10(6-4-9)17-15(22)19-18-14(21)12-8-11(20-23-12)13-2-1-7-24-13/h1-7,12H,8H2,(H,18,21)(H2,17,19,22) |
| InChIKey | KWILAUWFLKINFV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|