6-methylpiperidine-2-carboxylic acid

C7H13NO2 — CID 3815667

IUPAC6-methylpiperidine-2-carboxylic acid
SMILESCC1CCCC(C(=O)O)N1
InChIInChI=1S/C7H13NO2/c1-5-3-2-4-6(8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChIKeyIHLDCUQUFBWSJU-UHFFFAOYSA-N
MW143.19 g/mol
LogP0.60
Rot. Bonds1

About 6-methylpiperidine-2-carboxylic acid

6-methylpiperidine-2-carboxylic acid (PubChem CID 3815667) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 6-methylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name6-methylpiperidine-2-carboxylic acid
PubChem CID3815667
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name6-methylpiperidine-2-carboxylic acid
SMILESCC1CCCC(C(=O)O)N1
InChIInChI=1S/C7H13NO2/c1-5-3-2-4-6(8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)
InChIKeyIHLDCUQUFBWSJU-UHFFFAOYSA-N
XLogP0.60
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-methylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methylpiperidine-2-carboxylic acid?
The IUPAC name of 6-methylpiperidine-2-carboxylic acid (CID 3815667) is 6-methylpiperidine-2-carboxylic acid.
What is the SMILES notation for 6-methylpiperidine-2-carboxylic acid?
The canonical SMILES for 6-methylpiperidine-2-carboxylic acid is CC1CCCC(C(=O)O)N1.
What is the InChIKey of 6-methylpiperidine-2-carboxylic acid?
The InChIKey is IHLDCUQUFBWSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-3-2-4-6(8-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10).
What are the key properties of 6-methylpiperidine-2-carboxylic acid?
6-methylpiperidine-2-carboxylic acid has a molecular weight of 143.19 g/mol, XLogP of 0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpiperidine-2-carboxylic acid is sourced from PubChem (CID 3815667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).