C27H24N2O2S — CID 3815704
5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 3815704) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3815704 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-1,3-diphenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C(CC1C(=O)N(c2ccccc2)C(=S)N1c1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H24N2O2S/c30-25(21-16-15-19-9-7-8-10-20(19)17-21)18-24-26(31)29(23-13-5-2-6-14-23)27(32)28(24)22-11-3-1-4-12-22/h1-6,11-17,24H,7-10,18H2 |
| InChIKey | LWANXKBOICVAER-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|