C27H32N6O3S — CID 3815761
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[1-[2-(4-hexoxyphenoxy)ethyl]indol-3-yl]methylideneamino]acetamide (PubChem CID 3815761) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[1-[2-(4-hexoxyphenoxy)ethyl]indol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[1-[2-(4-hexoxyphenoxy)ethyl]indol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3815761 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[[1-[2-(4-hexoxyphenoxy)ethyl]indol-3-yl]methylideneamino]acetamide |
| SMILES | CCCCCCOc1ccc(OCCn2cc(C=NNC(=O)Cc3nnc(N)s3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H32N6O3S/c1-2-3-4-7-15-35-21-10-12-22(13-11-21)36-16-14-33-19-20(23-8-5-6-9-24(23)33)18-29-30-25(34)17-26-31-32-27(28)37-26/h5-6,8-13,18-19H,2-4,7,14-17H2,1H3,(H2,28,32)(H,30,34) |
| InChIKey | RCYODCHPMFANSK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|