C15H21FN2O2 — CID 38163692
1-cyclopentyl-3-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]urea (PubChem CID 38163692) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 38163692 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-cyclopentyl-3-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc([C@H](C)NC(=O)NC2CCCC2)cc1F |
| InChI | InChI=1S/C15H21FN2O2/c1-10(11-7-8-14(20-2)13(16)9-11)17-15(19)18-12-5-3-4-6-12/h7-10,12H,3-6H2,1-2H3,(H2,17,18,19)/t10-/m0/s1 |
| InChIKey | VKJBEHYOGWVKRU-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |