C12H4Cl6O4S — CID 3816490
3,4,6-trichloro-2-(2,3,5-trichloro-6-hydroxyphenyl)sulfonylphenol (PubChem CID 3816490) has the molecular formula C12H4Cl6O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is 3,4,6-trichloro-2-(2,3,5-trichloro-6-hydroxyphenyl)sulfonylphenol.
| Compound Name | 3,4,6-trichloro-2-(2,3,5-trichloro-6-hydroxyphenyl)sulfonylphenol |
|---|---|
| PubChem CID | 3816490 |
| Molecular Formula | C12H4Cl6O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 453.80 |
| IUPAC Name | 3,4,6-trichloro-2-(2,3,5-trichloro-6-hydroxyphenyl)sulfonylphenol |
| SMILES | O=S(=O)(c1c(O)c(Cl)cc(Cl)c1Cl)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl6O4S/c13-3-1-5(15)9(19)11(7(3)17)23(21,22)12-8(18)4(14)2-6(16)10(12)20/h1-2,19-20H |
| InChIKey | AKUKHICVNCCQHN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|