C20H25N3O2S — CID 38165800
N-[3-[2-(azepan-1-yl)anilino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 38165800) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[3-[2-(azepan-1-yl)anilino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[2-(azepan-1-yl)anilino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 38165800 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[3-[2-(azepan-1-yl)anilino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)Nc1ccccc1N1CCCCCC1 |
| InChI | InChI=1S/C20H25N3O2S/c24-19(9-11-21-20(25)16-10-14-26-15-16)22-17-7-3-4-8-18(17)23-12-5-1-2-6-13-23/h3-4,7-8,10,14-15H,1-2,5-6,9,11-13H2,(H,21,25)(H,22,24) |
| InChIKey | MPMQDNBPWXOMHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |