C20H21Cl2N3O4S — CID 38168403
N-[(2R)-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]benzamide (PubChem CID 38168403) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is N-[(2R)-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2R)-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 38168403 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[(2R)-1-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-oxopropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1)C(=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c1-14(23-19(26)15-5-3-2-4-6-15)20(27)24-9-11-25(12-10-24)30(28,29)18-13-16(21)7-8-17(18)22/h2-8,13-14H,9-12H2,1H3,(H,23,26)/t14-/m1/s1 |
| InChIKey | LXJYTCUNNPJFIJ-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |