C41H31N2S+ — CID 3816970
2-[4-(3,3-diphenyl-2-benzothiophen-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium (PubChem CID 3816970) has the molecular formula C41H31N2S+ and a molecular weight of 583.78 g/mol. Its IUPAC name is 2-[4-(3,3-diphenyl-2-benzothiophen-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium.
| Compound Name | 2-[4-(3,3-diphenyl-2-benzothiophen-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
|---|---|
| PubChem CID | 3816970 |
| Molecular Formula | C41H31N2S+ |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | 2-[4-(3,3-diphenyl-2-benzothiophen-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
| SMILES | C1=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=CC1=C1SC(c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C41H31N2S/c1-5-15-30(16-6-1)38-29-39(31-17-7-2-8-18-31)43(42-38)35-27-25-32(26-28-35)40-36-23-13-14-24-37(36)41(44-40,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-28,39H,29H2/q+1/b40-32-,43-35- |
| InChIKey | BVZOPMRWQSZOJV-NKZYGJDPSA-N |
| XLogP | 9.57 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|