C14H18ClFN2O4S — CID 3816990
ethyl 2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]acetate (PubChem CID 3816990) has the molecular formula C14H18ClFN2O4S and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl 2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 3816990 |
| Molecular Formula | C14H18ClFN2O4S |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | ethyl 2-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18ClFN2O4S/c1-2-22-14(19)10-17-5-7-18(8-6-17)23(20,21)11-3-4-13(16)12(15)9-11/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | SIPUONRLVNSWFT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |