C11H21N3O3 — CID 38170461
2-(cyclopentylcarbamoylamino)-N-(2-methoxyethyl)acetamide (PubChem CID 38170461) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(cyclopentylcarbamoylamino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(cyclopentylcarbamoylamino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 38170461 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-(cyclopentylcarbamoylamino)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNC(=O)NC1CCCC1 |
| InChI | InChI=1S/C11H21N3O3/c1-17-7-6-12-10(15)8-13-11(16)14-9-4-2-3-5-9/h9H,2-8H2,1H3,(H,12,15)(H2,13,14,16) |
| InChIKey | CYWQPCCLPLDEMQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|