About 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium
3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium (PubChem CID 3817131) has the molecular formula C8H16NO4S+
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium.
Molecular Properties
| Compound Name | 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium |
| PubChem CID | 3817131 |
| Molecular Formula | C8H16NO4S+ |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium |
| SMILES | O=C(O)CCC[NH2+]C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c10-8(11)2-1-4-9-7-3-5-14(12,13)6-7/h7,9H,1-6H2,(H,10,11)/p+1 |
| InChIKey | LOYVVYSXUYAYIB-UHFFFAOYSA-O |
| XLogP | -1.40 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium?
The IUPAC name of 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium (CID 3817131) is 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium.
What is the SMILES notation for 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium?
The canonical SMILES for 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium is O=C(O)CCC[NH2+]C1CCS(=O)(=O)C1.
What is the InChIKey of 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium?
The InChIKey is LOYVVYSXUYAYIB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H15NO4S/c10-8(11)2-1-4-9-7-3-5-14(12,13)6-7/h7,9H,1-6H2,(H,10,11)/p+1.
What are the key properties of 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium?
3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium has a molecular weight of 222.29 g/mol, XLogP of -1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxypropyl-(1,1-dioxothiolan-3-yl)azanium is sourced from PubChem (CID 3817131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).