C14H9Cl2F6N3O2 — CID 3817281
2,4-dichloro-N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propan-2-yl]benzamide (PubChem CID 3817281) has the molecular formula C14H9Cl2F6N3O2 and a molecular weight of 436.14 g/mol. Its IUPAC name is 2,4-dichloro-N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 3817281 |
| Molecular Formula | C14H9Cl2F6N3O2 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 2,4-dichloro-N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propan-2-yl]benzamide |
| SMILES | Cc1cc(NC(NC(=O)c2ccc(Cl)cc2Cl)(C(F)(F)F)C(F)(F)F)no1 |
| InChI | InChI=1S/C14H9Cl2F6N3O2/c1-6-4-10(25-27-6)23-12(13(17,18)19,14(20,21)22)24-11(26)8-3-2-7(15)5-9(8)16/h2-5H,1H3,(H,23,25)(H,24,26) |
| InChIKey | MVOHVPRPAOBSRA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|