C11H10F9NO — CID 3817769
3,4,4,5,5,5-hexafluoro-1-piperidin-1-yl-2-(trifluoromethyl)pent-2-en-1-one (PubChem CID 3817769) has the molecular formula C11H10F9NO and a molecular weight of 343.19 g/mol. Its IUPAC name is 3,4,4,5,5,5-hexafluoro-1-piperidin-1-yl-2-(trifluoromethyl)pent-2-en-1-one.
| Compound Name | 3,4,4,5,5,5-hexafluoro-1-piperidin-1-yl-2-(trifluoromethyl)pent-2-en-1-one |
|---|---|
| PubChem CID | 3817769 |
| Molecular Formula | C11H10F9NO |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3,4,4,5,5,5-hexafluoro-1-piperidin-1-yl-2-(trifluoromethyl)pent-2-en-1-one |
| SMILES | O=C(C(=C(F)C(F)(F)C(F)(F)F)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C11H10F9NO/c12-7(9(13,14)11(18,19)20)6(10(15,16)17)8(22)21-4-2-1-3-5-21/h1-5H2 |
| InChIKey | HYUSFSGLFJMHOW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|