C18H15Cl5O5S — CID 3818264
(2,3,4,5,6-pentachlorophenyl)methyl 3-ethyl-2-methoxy-4-methylsulfonylbenzoate (PubChem CID 3818264) has the molecular formula C18H15Cl5O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl)methyl 3-ethyl-2-methoxy-4-methylsulfonylbenzoate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl)methyl 3-ethyl-2-methoxy-4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 3818264 |
| Molecular Formula | C18H15Cl5O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 517.91 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl)methyl 3-ethyl-2-methoxy-4-methylsulfonylbenzoate |
| SMILES | CCc1c(S(C)(=O)=O)ccc(C(=O)OCc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1OC |
| InChI | InChI=1S/C18H15Cl5O5S/c1-4-8-11(29(3,25)26)6-5-9(17(8)27-2)18(24)28-7-10-12(19)14(21)16(23)15(22)13(10)20/h5-6H,4,7H2,1-3H3 |
| InChIKey | CYEKEBLTUJXCQP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|