About 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine
3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine (PubChem CID 3818607) has the molecular formula C14H14N6
and a molecular weight of 266.31 g/mol. Its IUPAC name is 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine |
| PubChem CID | 3818607 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine |
| SMILES | Nc1ccccc1-c1nnc(-c2ccccc2N)n1N |
| InChI | InChI=1S/C14H14N6/c15-11-7-3-1-5-9(11)13-18-19-14(20(13)17)10-6-2-4-8-12(10)16/h1-8H,15-17H2 |
| InChIKey | NUDMJBMSVRCFAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine (CID 3818607) is 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine is Nc1ccccc1-c1nnc(-c2ccccc2N)n1N.
What is the InChIKey of 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine?
The InChIKey is NUDMJBMSVRCFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6/c15-11-7-3-1-5-9(11)13-18-19-14(20(13)17)10-6-2-4-8-12(10)16/h1-8H,15-17H2.
What are the key properties of 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine?
3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine has a molecular weight of 266.31 g/mol, XLogP of 1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(2-aminophenyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 3818607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).