C20H11Br2N3O4 — CID 3818901
3-(2,5-dibromophenyl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-one (PubChem CID 3818901) has the molecular formula C20H11Br2N3O4 and a molecular weight of 517.13 g/mol. Its IUPAC name is 3-(2,5-dibromophenyl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-one.
| Compound Name | 3-(2,5-dibromophenyl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3818901 |
| Molecular Formula | C20H11Br2N3O4 |
| Molecular Weight | 517.13 g/mol |
| Exact Mass | 514.91 |
| IUPAC Name | 3-(2,5-dibromophenyl)-2-[2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C=Cc2ccc([N+](=O)[O-])o2)n1-c1cc(Br)ccc1Br |
| InChI | InChI=1S/C20H11Br2N3O4/c21-12-5-8-15(22)17(11-12)24-18(9-6-13-7-10-19(29-13)25(27)28)23-16-4-2-1-3-14(16)20(24)26/h1-11H |
| InChIKey | ZVKZBNPGYVRUSF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.13 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|