C20H29N3O3S — CID 3818927
N-(1-adamantyl)-2-[[4-(2-methylpropoxy)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 3818927) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[[4-(2-methylpropoxy)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[[4-(2-methylpropoxy)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3818927 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(1-adamantyl)-2-[[4-(2-methylpropoxy)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)COc1cc(=O)[nH]c(SCC(=O)NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C20H29N3O3S/c1-12(2)10-26-18-6-16(24)21-19(22-18)27-11-17(25)23-20-7-13-3-14(8-20)5-15(4-13)9-20/h6,12-15H,3-5,7-11H2,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | ZCFPYOGBQLHXEQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |