About ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate
ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate (PubChem CID 3819126) has the molecular formula C17H14F6N2O4S
and a molecular weight of 456.36 g/mol. Its IUPAC name is ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate |
| PubChem CID | 3819126 |
| Molecular Formula | C17H14F6N2O4S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F6N2O4S/c1-2-29-15(26)24-12-3-5-14(6-4-12)30(27,28)25-13-8-10(16(18,19)20)7-11(9-13)17(21,22)23/h3-9,25H,2H2,1H3,(H,24,26) |
| InChIKey | RAEABUFLNQPLIT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate?
The IUPAC name of ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate (CID 3819126) is ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate.
What is the SMILES notation for ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate?
The canonical SMILES for ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate is CCOC(=O)Nc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate?
The InChIKey is RAEABUFLNQPLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F6N2O4S/c1-2-29-15(26)24-12-3-5-14(6-4-12)30(27,28)25-13-8-10(16(18,19)20)7-11(9-13)17(21,22)23/h3-9,25H,2H2,1H3,(H,24,26).
What are the key properties of ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate?
ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate has a molecular weight of 456.36 g/mol, XLogP of 5.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]phenyl]carbamate is sourced from PubChem (CID 3819126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).