C24H19NO3 — CID 3819686
1-[3-(3-methoxyphenyl)-2,1-benzoxazol-5-yl]-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 3819686) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenyl)-2,1-benzoxazol-5-yl]-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | 1-[3-(3-methoxyphenyl)-2,1-benzoxazol-5-yl]-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3819686 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[3-(3-methoxyphenyl)-2,1-benzoxazol-5-yl]-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(-c2onc3ccc(C(=O)C=Cc4ccc(C)cc4)cc23)c1 |
| InChI | InChI=1S/C24H19NO3/c1-16-6-8-17(9-7-16)10-13-23(26)18-11-12-22-21(15-18)24(28-25-22)19-4-3-5-20(14-19)27-2/h3-15H,1-2H3 |
| InChIKey | MMXLWWZPYKFHQF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|