C19H21N3O5 — CID 38209412
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(methylamino)-5-nitrophenyl]methanone (PubChem CID 38209412) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(methylamino)-5-nitrophenyl]methanone.
| Compound Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(methylamino)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 38209412 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-[2-(methylamino)-5-nitrophenyl]methanone |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C19H21N3O5/c1-20-16-5-4-14(22(24)25)10-15(16)19(23)21-7-6-12-8-17(26-2)18(27-3)9-13(12)11-21/h4-5,8-10,20H,6-7,11H2,1-3H3 |
| InChIKey | RZTXYHQNYLIKLG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|