C13H9N3O3 — CID 3821471
8-nitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 3821471) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 8-nitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 8-nitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 3821471 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 8-nitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccccc2Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H9N3O3/c17-13-9-7-8(16(18)19)5-6-10(9)14-11-3-1-2-4-12(11)15-13/h1-7,14H,(H,15,17) |
| InChIKey | CHMWFXMDXQDWQR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|